| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | 2-(4-Boc-piperazinyl)-2-(3-pyridinyl)acetic acid Basic information |
| | 2-(4-Boc-piperazinyl)-2-(3-pyridinyl)acetic acid Chemical Properties |
| Boiling point | 461.6±45.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.19±0.10(Predicted) | | form | powder or crystals | | color | white to faint beige | | Major Application | peptide synthesis | | InChI | 1S/C16H23N3O4/c1-16(2,3)23-15(22)19-9-7-18(8-10-19)13(14(20)21)12-5-4-6-17-11-12/h4-6,11,13H,7-10H2,1-3H3,(H,20,21) | | InChIKey | UOZAIRMXJCRTJN-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(C(O)=O)c2cccnc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(4-Boc-piperazinyl)-2-(3-pyridinyl)acetic acid Usage And Synthesis |
| | 2-(4-Boc-piperazinyl)-2-(3-pyridinyl)acetic acid Preparation Products And Raw materials |
|