|
|
| | Tris(4-bromophenyl)amine Basic information |
| | Tris(4-bromophenyl)amine Chemical Properties |
| Melting point | 141-143 °C (lit.) | | Boiling point | 514.9±45.0 °C(Predicted) | | density | 1.790±0.06 g/cm3(Predicted) | | Fp | 100°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in toluene. | | form | powder to crystal | | pka | -4.91±0.50(Predicted) | | color | White to Almost white | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H | | InChIKey | ZRXVCYGHAUGABY-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(Br)C=C2)C2=CC=C(Br)C=C2)=CC=C(Br)C=C1 | | CAS DataBase Reference | 4316-58-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tris(4-bromophenyl)amine Usage And Synthesis |
| Description | Tris(4-bromophenyl)amine (TBPA) is a precursor to the oxidising agent Magic Blue. TBPA can be oxidised at relatively accessible electrode potentials, and its radical cation acts as a relatively mild single-electron oxidising agent, allowing for better control of the reaction rate. TBPA is commonly used in photochemical and electrochemical ESR studies. | | Chemical Properties | Tris(4-bromophenyl)amine typically appears as a white crystalline powder at room temperature and pressure. This compound is chemically active and reacts with oxidants and acid mixtures. | | Uses | Tris(4-bromophenyl)amine was used in the synthesis of porous luminescent covalent--organic polymers (COPs) | | Application | Tri(4-bromophenyl)amine is a key raw material for the synthesis of a novel three-branched triphenylamine organoboron complex (TPAB). TPAB can be successfully synthesized through Suzuki coupling, condensation, and coordination reactions with 4-aminophenylboronic acid pinacol ester, 4-diethylaminosalicylaldehyde, and boron trifluoride etherate. |
| | Tris(4-bromophenyl)amine Preparation Products And Raw materials |
| Raw materials | 3,6-Ethano-3,4,5,6-tetrahydropyridazine-->N4,N4,N4',N4'-tetrakis(4-bromophenyl)-[1,1'-biphenyl]-4,4'-diamine-->4-Bromotriphenylamine-->3,6-Dibromo-9-(4-bromo-phenyl)-9H-carbazole-->Triphenylamine | | Preparation Products | Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)--->N-(4-BroMophenyl)-N,N-bis(1,1'-biphenyl-4-yl)aMine-->4-(1-Pyrenyl)-N,N-bis[4-(1-pyrenyl)phenyl]benzenamine |
|