|
|
| | Dimethyl-d6 phthalate Basic information |
| | Dimethyl-d6 phthalate Chemical Properties |
| Melting point | 2 °C(lit.) | | Boiling point | 282 °C(lit.) | | density | 1.214 g/mL at 25 °C | | Fp | 146℃ | | solubility | Acetone (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | InChI | 1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3/i1D3,2D3 | | InChIKey | NIQCNGHVCWTJSM-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])OC(=O)c1ccccc1C(=O)OC([2H])([2H])[2H] | | EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, di(methyl-d3) ester (85448-30-2) |
| RIDADR | UN 3082 9 / PGIII | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | Dimethyl-d6 phthalate Usage And Synthesis |
| Uses | Phthalic Acid Di(methyl-d3) Ester is deuterium labelled Dimethyl Phalate (D477976), the methyl ester of phthalic acid. Dimethyl phthalate is an ectoparasiticide and has many other uses, including in solid rocket propellants, plastics, and insect repellents. |
| | Dimethyl-d6 phthalate Preparation Products And Raw materials |
|