| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Dimethyl phthalate-3,4,5,6-d4, 98%, 98 atom % D CAS:93951-89-4 Purity:98% Package:25MG;5MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:DiMethyl phthalate-3,4,5,6-d4 CAS:93951-89-4 Purity:98 atoM % D Package:100MG
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:DiMethyl Phthalate--d4 CAS:93951-89-4 Remarks:CS-C-00470
|
|
| | DIMETHYL PHTHALATE (RING-D4) Basic information |
| Product Name: | DIMETHYL PHTHALATE (RING-D4) | | Synonyms: | Dimethyl Phthalate-3,4,5,6-d4 DIMETHYL PHTHALATE-3,4,5,6-D4;DIMETHYL PHTHALATE-D4;DIMETHYL PHTHALATE (RING-D4);DIMETHYL PHTHALATE-3,4,5,6-D4, 98 ATOM % D;Phthalic acid, bis-methyl ester D4;Dimethyl phthalate-3, 4, 5, 6-d4 Solution, 100ppm;Dimethyl phthalate-3,4,5,6-d4, 98%, 98 atom % D | | CAS: | 93951-89-4 | | MF: | C10H10O4 | | MW: | 194.19 | | EINECS: | | | Product Categories: | Alphabetical Listings;DPesticides&Metabolites;LabeledPesticides&Metabolites;Others;Pesticides;Stable Isotopes | | Mol File: | 93951-89-4.mol |  |
| | DIMETHYL PHTHALATE (RING-D4) Chemical Properties |
| Melting point | 2 °C(lit.) | | Boiling point | 282 °C(lit.) | | density | 1.214 g/mL at 25 °C | | refractive index | n20/D 1.515(lit.) | | Fp | 295 °F | | storage temp. | Room Temperature, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | Major Application | cleaning products cosmetics environmental food and beverages personal care | | InChI | 1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3/i3D,4D,5D,6D | | InChIKey | NIQCNGHVCWTJSM-LNFUJOGGSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(=O)OC)c(c1[2H])C(=O)OC | | EPA Substance Registry System | Dimethyl phthalate-d4 (93951-89-4) | | CAS Number Unlabeled | 131-11-3 |
| RIDADR | UN 3082 9 / PGIII | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids |
| | DIMETHYL PHTHALATE (RING-D4) Usage And Synthesis |
| Uses | This product may be used as an analytical standard. |
| | DIMETHYL PHTHALATE (RING-D4) Preparation Products And Raw materials |
|