|
|
| | Quercetagetin 3,5,6,7,3',4'-hexamethyl ether Basic information |
| Product Name: | Quercetagetin 3,5,6,7,3',4'-hexamethyl ether | | Synonyms: | 3,3',4',5,6,7-Hexamethoxyflavone;Hexamethylquercetagetin;Oxyayanin B trimethyl ether;Quercetagetin 3,5,6,7,3',4'-hexamethyl ether;Quercetagetin hexamethyl ether;Quercetogetin;(Synonyms: Hexa-O-methylquercetagetin;(SYNONYMS: HEXA-O-METHYLQUERCETAGETIN; QUERCETAGETIN HEXAMETHYL ETHER; 3;?5;?6;?7;?3';?4'-?HEXAMETHOXYFLAVONE) | | CAS: | 1251-84-9 | | MF: | C21H22O8 | | MW: | 402.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1251-84-9.mol |  |
| | Quercetagetin 3,5,6,7,3',4'-hexamethyl ether Chemical Properties |
| Melting point | 142-144 °C(Solv: ethanol (64-17-5)) | | Boiling point | 580.0±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: slightly soluble | | form | solid | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C21H22O8/c1-23-12-8-7-11(9-13(12)24-2)18-21(28-6)17(22)16-14(29-18)10-15(25-3)19(26-4)20(16)27-5/h7-10H,1-6H3 | | InChIKey | CHXSDKWBSFDZEU-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](c(c1c3cc(c(cc3)OC)OC)OC)=O)c(c(c(c2)OC)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Quercetagetin 3,5,6,7,3',4'-hexamethyl ether Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Definition | ChEBI: 2-(3,4-dimethoxyphenyl)-3,5,6,7-tetramethoxy-1-benzopyran-4-one is a member of flavonoids and an ether. |
| | Quercetagetin 3,5,6,7,3',4'-hexamethyl ether Preparation Products And Raw materials |
|