(2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester manufacturers
|
| | (2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester Basic information |
| Product Name: | (2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester | | Synonyms: | TERT-BUTYL N-(2-OXO-2-PHENYLETHYL)CARBAMATE;CarbaMic acid, N-[(1S)-2-(MethoxyMethylaMino)-1-Methyl-2-oxoethyl]-, phenylMethyl ester;Benzyl [(2S)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate;benzylN-[(2S)-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate;(S)-benzyl (1-(N,O-dimethylhydroxylamine)-1-oxopropan-2-yl)carbamate;N-Cbz-L-alanine (N-methoxy-N-methyl)-amide;Phenylmethyl N-[(1S)-2-(methoxymethylamino)-1-methyl-2-oxoethyl]carbamate;Metaraminol bitartrate Impurity 68 | | CAS: | 114744-83-1 | | MF: | C13H18N2O4 | | MW: | 266.29 | | EINECS: | | | Product Categories: | | | Mol File: | 114744-83-1.mol |  |
| | (2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester Chemical Properties |
| Melting point | 87-89 °C | | density | 1.166±0.06 g/cm3(Predicted) | | pka | 10.98±0.46(Predicted) | | InChI | InChI=1/C13H18N2O4/c1-10(12(16)15(2)18-3)14-13(17)19-9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,14,17)/t10-/s3 | | InChIKey | JJWLCBIYQXRMNO-JQHDBZEONA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)N[C@@H](C)C(N(OC)C)=O |&1:11,r| |
| | (2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester Usage And Synthesis |
| Synthesis Reference(s) | Canadian Journal of Chemistry, 69, p. 2059, 1991 DOI: 10.1139/v91-298 |
| | (2-Oxo-2-phenyl-ethyl)-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|