| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | (S)-2-(Boc-amino)-1,3-diphenyl-1-propanone Basic information |
| | (S)-2-(Boc-amino)-1,3-diphenyl-1-propanone Chemical Properties |
| Boiling point | 491.1±45.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | storage temp. | Store at -15°C | | pka | 11.22±0.46(Predicted) | | form | powder | | color | beige | | Major Application | peptide synthesis | | InChI | 1S/C20H23NO3/c1-20(2,3)24-19(23)21-17(14-15-10-6-4-7-11-15)18(22)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,21,23)/t17-/m0/s1 | | InChIKey | ACUYZILXZGMZSY-KRWDZBQOSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)c2ccccc2 |
| WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | (S)-2-(Boc-amino)-1,3-diphenyl-1-propanone Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | peptide synthesis |
| | (S)-2-(Boc-amino)-1,3-diphenyl-1-propanone Preparation Products And Raw materials |
|