| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Oxetanecarboxylic acid, 3-methyl Basic information |
| Product Name: | 3-Oxetanecarboxylic acid, 3-methyl | | Synonyms: | 3-methyloxetane-3-carboxylicacid;3-methyloxetane carboxylic acid;3-Methyl-3-oxetanecarboxylic acid;3-Methyloxetane-3-carboxy...;3-Methyloxetane-3-Carboxylic Acid(WX610267);3-Methyloxetane-3-carboxylic acid 98%;3-Methyloxetane-3-carboxylicacid,96%;3-Methyloxetane-3-carboxylic acid - [M6214] | | CAS: | 28562-68-7 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 28562-68-7.mol |  |
| | 3-Oxetanecarboxylic acid, 3-methyl Chemical Properties |
| Melting point | 58-60℃ | | Boiling point | 224℃ | | density | 1.252 | | Fp | 99℃ | | storage temp. | -20°C | | form | Powder | | pka | 3.95±0.20(Predicted) | | color | White to yellow | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C5H8O3/c1-5(4(6)7)2-8-3-5/h2-3H2,1H3,(H,6,7) | | InChIKey | PMPZEEUNGQSAIQ-UHFFFAOYSA-N | | SMILES | O1CC(C)(C(O)=O)C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Oxetanecarboxylic acid, 3-methyl Usage And Synthesis |
| | 3-Oxetanecarboxylic acid, 3-methyl Preparation Products And Raw materials |
|