| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Ethyl-2-methylpyridine borane Basic information |
| Product Name: | 5-Ethyl-2-methylpyridine borane | | Synonyms: | 5-Ethyl-2-methylpyridine borane;PEMB;Pyridine,5-ethyl-2-Methyl-, coMpd. with boron (1:1);borane,5-ethyl-2-methyl-pyridine;5-Ethyl-2-methylpyridine borane ISO 9001:2015 REACH | | CAS: | 1006873-58-0 | | MF: | C8H11N.BH3 | | MW: | 135.01446 | | EINECS: | 640-972-9 | | Product Categories: | | | Mol File: | 1006873-58-0.mol |  |
| | 5-Ethyl-2-methylpyridine borane Chemical Properties |
| InChI | InChI=1S/C8H11N.BH3/c1-3-8-5-4-7(2)9-6-8;/h4-6H,3H2,1-2H3;1H3 | | InChIKey | MNMBLEICNIBHKB-UHFFFAOYSA-N | | SMILES | C1(C)=NC=C(CC)C=C1.B |
| | 5-Ethyl-2-methylpyridine borane Usage And Synthesis |
| Uses | 5-Ethyl-2-methylpyridine Borane is a reducing agent used in the PEGylation of recombinant human IL-10. |
| | 5-Ethyl-2-methylpyridine borane Preparation Products And Raw materials |
|