| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,5-Dibromophenylacetic acid Basic information |
| Product Name: | 2,5-Dibromophenylacetic acid | | Synonyms: | 2,5-Dibromophenylacetic acid;Dibromophenylacetic acid;2-(2,5-DibroMophenyl)acetic acid;2,5-Dibromobenzeneacetic acid;Benzeneacetic acid, 2,5-dibromo-;5-Dibromophenylacetic acid | | CAS: | 203314-28-7 | | MF: | C8H6Br2O2 | | MW: | 293.94 | | EINECS: | | | Product Categories: | | | Mol File: | 203314-28-7.mol |  |
| | 2,5-Dibromophenylacetic acid Chemical Properties |
| Boiling point | 376.4±27.0 °C(Predicted) | | density | 1.969±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | claggy powder | | pka | 3.87±0.10(Predicted) | | color | Cream to faint tan | | InChI | InChI=1S/C8H6Br2O2/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H,11,12) | | InChIKey | NKZKFWYEXDBOTP-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(Br)=CC=C1Br |
| | 2,5-Dibromophenylacetic acid Usage And Synthesis |
| Uses | 2-(2,5-Dibromophenyl)acetic Acid is used as a reactant in the synthesis of MK-8742, a HCV NS5a inhibitor. | | Synthesis | In a 500 mL four-necked reaction flask, 82 g of 2-(2,5-dibromophenyl)acetonitrile was added to 400 mL of aqueous 2 N sodium hydroxide, and the mixture was heated to 100 °C and refluxed. The reaction progress was monitored by TLC. After completion of the reaction, the mixture was cooled to room temperature and the pH was adjusted with 36% hydrochloric acid by slow dropwise addition to 8. The aqueous layer was separated by extraction with ethyl acetate. Subsequently, the pH of the aqueous layer was adjusted to 1-2 with 36% hydrochloric acid, at which point a solid precipitated. The off-white solid 2-(2,5-dibromophenyl)acetic acid was collected by filtration and dried to give 73 g in 83% yield. | | References | [1] Patent: CN107759459, 2018, A. Location in patent: Paragraph 0007; 0008; 0017; 0018
[2] Synlett, 2011, # 17, p. 2525 - 2528
[3] Journal of Medicinal Chemistry, 2006, vol. 49, # 12, p. 3563 - 3580 |
| | 2,5-Dibromophenylacetic acid Preparation Products And Raw materials |
|