- 1-Bromo-3,4-difluorobenzene
-
- $100.00 / 1KG
-
2025-09-25
- CAS:348-61-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Bromo-1,2-difluorobenzene Basic information |
| Product Name: | 4-Bromo-1,2-difluorobenzene | | Synonyms: | Benzene, 4-bromo-1,2-difluoro-;4-BROMO-1,2-DIFLUOROBENZENE;3,4-DIFLUOROBROMOBENZENE;3,4-Difluoro-1-Bromobenzene;1-Bromo-3,4-difluorobenzene 98%;1-Bromo-3,4-difluorobenzene98%;4-Brom-1,2-difluorbenzol;4-bromo-1,2-difluorobenzene(3,4-difluoro-bromobenzene) | | CAS: | 348-61-8 | | MF: | C6H3BrF2 | | MW: | 192.99 | | EINECS: | 206-481-5 | | Product Categories: | Fluorine series;alkyl Fluorine| alkyl bromide;Aryl;Halogenated Hydrocarbons;Fluorobenzene;Aromatic Hydrocarbons (substituted) & Derivatives;Heterocyclic Compounds;Miscellaneous;Bromine Compounds;Fluorine Compounds;bc0001;C6 | | Mol File: | 348-61-8.mol |  |
| | 4-Bromo-1,2-difluorobenzene Chemical Properties |
| Melting point | -4 °C | | Boiling point | 150-151 °C(lit.) | | density | 1.707 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.505(lit.) | | Fp | 92 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Clear colorless to pale yellow | | Specific Gravity | 1.707 | | Water Solubility | insoluble | | BRN | 1934811 | | InChI | InChI=1S/C6H3BrF2/c7-4-1-2-5(8)6(9)3-4/h1-3H | | InChIKey | YMQPKONILWWJQG-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(Br)C=C1F | | CAS DataBase Reference | 348-61-8(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Bromo-3,4-difluorobenzene(348-61-8) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39-37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Flam. Liq. 3
Skin Irrit. 2
Skin Sens. 1 |
| | 4-Bromo-1,2-difluorobenzene Usage And Synthesis |
| Chemical Properties | clear colorless to pale yellow liquid | | Uses | Intermediates of Liquid Crystals | | Uses | 4-Bromo-1,2-difluorobenzene has been used in the preparation of 4-benzyl-2-(3,4-difluorophenyl)-2-hydroxy-morpholine. | | General Description | Regioselective nucleophilic aromatic substitution reaction of 4-bromo-1,2-difluorobenzene with benzyl alcohol has been investigated. |
| | 4-Bromo-1,2-difluorobenzene Preparation Products And Raw materials |
|