| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
[2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone manufacturers
- LY 2087101
-
- $2970.00
-
2026-04-22
- CAS:913186-74-0
- Purity:
- Supply Ability: 10g
|
| | [2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone Basic information |
| | [2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone Chemical Properties |
| Melting point | 160 - 163°C | | Boiling point | 449.1±55.0 °C(Predicted) | | density | 1.407±0.06 g/cm3(Predicted) | | storage temp. | Store at +4°C | | solubility | DMSO: soluble20mg/mL, clear | | pka | 2.71±0.10(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C15H11FN2OS2/c1-9-14(13(19)10-6-7-20-8-10)21-15(17-9)18-12-4-2-11(16)3-5-12/h2-8H,1H3,(H,17,18) | | InChIKey | PEAMDZVDNYENPN-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)Nc2[s]c(c(n2)C)C(=O)c3c[s]cc3 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | [2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone Usage And Synthesis |
| Uses | LY 2087101 is a positive allosteric Nicotinic acetylcholine receptor (nAChR) modulators. nAChRs are found in the CNS and they respond to neurotransmitter acetylcholine. | | Biological Activity | LY 2087101 is a selective positive allosteric potentiator of α7 and α4β2 nicotinic acetylcholine receptors (nAChRs). LY 2087101 was shown to not enhance the activity of α3β4 subtype nAChRs. | | storage | Store at +4°C |
| | [2-[(4-Fluorophenyl)amino]-4-methyl-5-thiazolyl]-3-thienylmethanone Preparation Products And Raw materials |
|