| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester Basic information |
| Product Name: | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester | | Synonyms: | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester;2-(3-(1,3-dioxolan-2-yl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,5,5-tetramethyl- | | CAS: | 1257648-34-2 | | MF: | C15H21BO4 | | MW: | 276.14 | | EINECS: | | | Product Categories: | Aryl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 1257648-34-2.mol |  |
| | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester Chemical Properties |
| Melting point | 45-50℃ | | Boiling point | 386.9±37.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | Fp | >110°C | | form | solid | | InChI | 1S/C15H21BO4/c1-14(2)15(3,4)20-16(19-14)12-7-5-6-11(10-12)13-17-8-9-18-13/h5-7,10,13H,8-9H2,1-4H3 | | InChIKey | SVIZIDROXRZRQS-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccc(c2)C3OCCO3 |
| WGK Germany | 1 | | Storage Class | 13 - Non Combustible Solids |
| | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester Usage And Synthesis |
| | 3-(1,3-Dioxolan-2-yl)phenylboronic acid pinacol ester Preparation Products And Raw materials |
|