|
|
| | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol Basic information | | Uses |
| Product Name: | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol | | Synonyms: | 3-Hydroxymethylphenylboronic acid, pinacol ester;3-(Hydroxymethyl)benzeneboronicacid,pinacolester96%;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Alcohol;3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzenemethanol;2-(3-Hydroxymethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;Benzenemethanol, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;3-(Hydroxymethyl)phenylboronic acid pinacol ester - [H3213] | | CAS: | 443776-76-9 | | MF: | C13H19BO3 | | MW: | 234.1 | | EINECS: | | | Product Categories: | Aryl;Boronate Esters;Boronic Acids and Derivatives;blocks;BoronicAcids;Aryl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 443776-76-9.mol |  |
| | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol Chemical Properties |
| Melting point | 42-46 °C | | Boiling point | 363.7±25.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | Inert atmosphere,2-8°C | | pka | 14.34±0.10(Predicted) | | form | powder to lump | | color | White to Almost white | | InChI | InChI=1S/C13H19BO3/c1-12(2)13(3,4)17-14(16-12)11-7-5-6-10(8-11)9-15/h5-8,15H,9H2,1-4H3 | | InChIKey | ZEWWJJQAFTXUIS-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids |
| | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol Usage And Synthesis |
| Uses | Pinaryl 3-hydroxymethylphenylboronic acid can be used as a pharmaceutical synthesis intermediate. | | Synthesis | GENERAL METHOD: Methanol (12.50 mL) was added to a mixture of 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (1a, 375 mg, 2.50 mmol), pinacol (355 mg, 3.00 mmol) and anhydrous magnesium sulfate (625 mg, 5.00 mmol). The mixture was stirred at room temperature for 6 hours. Upon completion of the reaction, the crude reaction mixture was filtered and then sodium borohydride (47 mg, 1.25 mmol) was added to the filtrate. Subsequently, the reaction mixture was stirred for another 5 hours. After completion of the reaction, the reaction mixture was filtered and the filtrate was concentrated in vacuum to afford the target product 3-hydroxymethylphenylboronic acid pinacol ester (2a) as a white solid (melting point 75-77 °C) in 88% yield (513 mg).1H-NMR (CD3OD-d4) δ ppm: 7.71 (d, J=8.0 Hz, 2H), 7.35 (d, J=7.8 Hz. 2H), 4.62 (s, 2H), 1.34 (s, 12H); 13C-NMR (CD3OD-d4) δppm: 146.23, 135.93, 127.26, 85.19, 65.24, 25.34; 11B-NMR (CDCl3) δppm: 34.82. | | References | [1] Molecules, 2013, vol. 18, # 10, p. 12346 - 12367 |
| | (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol Preparation Products And Raw materials |
| Raw materials | 3-(Hydroxymethyl)phenylboronic acid-->3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-BENZALDEHYDE-->3-Methoxycarbonylphenylboronic acid pinacol ester-->(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol-->3-Formylphenylboronic acid-->Pinacol-->Benzyl alcohol-->Bis(pinacolato)diboron | | Preparation Products | 3-(4-Methyl-1-piperazinylmethyl)benzeneboronic acid pinacol ester, 97% |
|