|
|
| | 3-(Methoxymethyl)phenylboronic acid, pinacol ester Basic information |
| Product Name: | 3-(Methoxymethyl)phenylboronic acid, pinacol ester | | Synonyms: | 1,3,2-Dioxaborolane, 2-[3-(MethoxyMethyl)phenyl]-4,4,5,5-tetraMethyl-;2-(3-(Methoxymethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;3-(Methoxymethyl)phenylboronic acid, pinacol ester | | CAS: | 675605-91-1 | | MF: | C14H21BO3 | | MW: | 248.13 | | EINECS: | | | Product Categories: | | | Mol File: | 675605-91-1.mol |  |
| | 3-(Methoxymethyl)phenylboronic acid, pinacol ester Chemical Properties |
| storage temp. | Store at room temperature | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C14H21BO3/c1-13(2)14(3,4)18-15(17-13)12-8-6-7-11(9-12)10-16-5/h6-9H,10H2,1-5H3 | | InChIKey | FDTVLJCTUKZTMS-UHFFFAOYSA-N | | SMILES | COCc1cccc(c1)B2OC(C)(C)C(C)(C)O2 |
| WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 3-(Methoxymethyl)phenylboronic acid, pinacol ester Usage And Synthesis |
| | 3-(Methoxymethyl)phenylboronic acid, pinacol ester Preparation Products And Raw materials |
|