|
|
| | lactiflorin Basic information |
| Product Name: | lactiflorin | | Synonyms: | 1,2-O-[9-[(Benzoyloxy)methyl]-4-methyl-8-oxo-7-oxatricyclo[4.3.0.0(3,9)]nonane-4,3-diyl]-beta-D-glucopyranose;β-D-Glucopyranose, 1,2-O-[9-[(benzoyloxy)methyl]-4-methyl-8-oxo-7-oxatricyclo[4.3.0.03,9]nonane-4,3-diyl]-;lactiflorin USP/EP/BP | | CAS: | 88623-95-4 | | MF: | C23H26O10 | | MW: | 462.45 | | EINECS: | | | Product Categories: | | | Mol File: | 88623-95-4.mol |  |
| | lactiflorin Chemical Properties |
| Melting point | 195-198℃ | | Boiling point | 716.033±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.566±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 13.034±0.70(predicted) | | InChIKey | SKVHDMAJGHRJJZ-LZXLKWECNA-N | | SMILES | O1C23C4(COC(=O)C5=CC=CC=C5)C(C(OC4=O)CC2(O[C@@H]2[C@H]([C@@H]([C@@H](CO)O[C@@H]12)O)O)C)C3 |&1:21,22,23,24,28,r| | | CAS DataBase Reference | 88623-95-4 |
| | lactiflorin Usage And Synthesis |
| | lactiflorin Preparation Products And Raw materials |
|