|
|
| | 1-BroMo-3,4,5-trifluoro-2-nitrobenzene Basic information |
| | 1-BroMo-3,4,5-trifluoro-2-nitrobenzene Chemical Properties |
| storage temp. | Store at room temperature | | form | liquid | | color | Light yellow to yellow | | InChI | 1S/C6HBrF3NO2/c7-2-1-3(8)4(9)5(10)6(2)11(12)13/h1H | | InChIKey | LTQKIGJLQQCSLS-UHFFFAOYSA-N | | SMILES | O=[N+](C1=C(F)C(F)=C(F)C=C1Br)[O-] |
| RIDADR | UN2810 | | WGK Germany | WGK 3 | | HazardClass | 6.1 | | HS Code | 2904990090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-BroMo-3,4,5-trifluoro-2-nitrobenzene Usage And Synthesis |
| | 1-BroMo-3,4,5-trifluoro-2-nitrobenzene Preparation Products And Raw materials |
|