|
|
| | 2-Bromo-6-fluoronitrobenzene Basic information |
| Product Name: | 2-Bromo-6-fluoronitrobenzene | | Synonyms: | 1-Bromo-3-fluoro-2-nitrobenzene;2-fluoro-6-bromonitrobenzene;2-Bromo-6-fluoronitrobenzene 97%;1-Bromo-3-fluoro-2-nitrobenzene >;Benzene, 1-bromo-3-fluoro-2-nitro-;1-Bromo-3-fluoro-2-nitrobenzene ISO 9001：2015 REACH;3-bromo-3-fluoro-2-nitrobenzene;2-BROMO-6-FLUORONITROBENZENE | | CAS: | 886762-70-5 | | MF: | C6H3BrFNO2 | | MW: | 220 | | EINECS: | 689-316-3 | | Product Categories: | | | Mol File: | 886762-70-5.mol |  |
| | 2-Bromo-6-fluoronitrobenzene Chemical Properties |
| Melting point | 36-37°C | | Boiling point | 232.0±20.0 °C(Predicted) | | density | 1.808±0.06 g/cm3(Predicted) | | Fp | 87° | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to lump | | color | White to Orange to Green | | InChI | InChI=1S/C6H3BrFNO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H | | InChIKey | VFPAOFBPEYCAAZ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(F)=C1[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 36 | | HazardClass | IRRITANT | | HS Code | 29042090 |
| | 2-Bromo-6-fluoronitrobenzene Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder | | Uses |
2-Bromo-6-fluoronitrobenzene is a hydrocarbon derivative, mainly used as an organic intermediate.
| | Reactions | The structure of 2-bromo-6-fluoronitrobenzene contains a nitro unit with high electron-withdrawing properties, which can easily undergo aromatic nucleophilic substitution reactions under the attack of common nucleophiles such as alcohols or amines. | | Synthesis | To a suspension of sodium perborate tetrahydrate (135.374 g., 886.4 mmol) in 500 mL of acetic acid at 55C was added dropwise
2-bromo-6-fluoroaniline (33.685 g., 177.271 mmol) in 70 mL
solution in acetic acid. The reaction mixture was stirred at 55 C. for an additional 3 h. and then cooled in an ice bath to 0 C. Insoluble material was removed by filtration through a diatomaceous earth plug and washed with 100 mL of acetic acid. The combined acetic acid was added to 3 liters of ice water with stirring to give a waxy solid which was removed by filtration.
The crude solid was dissolved in 250 mL of ethyl acetate and washed three times with 200 mL of 10% aqueous hydrogen chloride, 200 mL of saturated sodium bicarbonate, and 100 mL of brine.
Concentrate the solution in vacuum to give 2-bromo-6-fluoronitrobenzene as a red oil in 11.51 g yield. |
| | 2-Bromo-6-fluoronitrobenzene Preparation Products And Raw materials |
|