|
|
| | 2-Nitro-3,4-difluoro bromobenzene Basic information |
| Product Name: | 2-Nitro-3,4-difluoro bromobenzene | | Synonyms: | 6-Bromo-2,3-difluoronitrobenzene 95+%;6-Bromo-2,3-difluoronitrobenzene;2-bromo-5,6-difluoronitrobenzene;Benzene, 1-bromo-3,4-difluoro-2-nitro-;1-BROMO-3,4-DIFLUORO-2-NITROBENZENE;2-Nitro-3,4-difluoro bromobenzene | | CAS: | 884495-47-0 | | MF: | C6H2BrF2NO2 | | MW: | 237.99 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Nitro-3,4-difluoro bromobenzene Chemical Properties |
| Boiling point | 233.1±35.0 °C(Predicted) | | density | 1.890±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | color | Yellow | | InChI | InChI=1S/C6H2BrF2NO2/c7-3-1-2-4(8)5(9)6(3)10(11)12/h1-2H | | InChIKey | QYDCWSXHLDNEBD-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C(F)=C1[N+]([O-])=O |
| | 2-Nitro-3,4-difluoro bromobenzene Usage And Synthesis |
| | 2-Nitro-3,4-difluoro bromobenzene Preparation Products And Raw materials |
|