|
|
| | 3,4-Diethoxyphenethylamine Basic information |
| Product Name: | 3,4-Diethoxyphenethylamine | | Synonyms: | TIMTEC-BB SBB001870;RARECHEM AL BW 0522;ART-CHEM-BB B006619;3,4-DIETHOXYBENZENE ETHANAMINE;3,4-DIETHOXYPHENETHYLAMINE;3,4-DIETHOXYPHENYLETHYLAMINE;3,4-DIETHYLOXY PHENYL ETHYLAMINE;2-(3,4-DIETHOXYPHENYL)ETHANAMINE | | CAS: | 61381-04-2 | | MF: | C12H19NO2 | | MW: | 209.28 | | EINECS: | 262-752-8 | | Product Categories: | | | Mol File: | 61381-04-2.mol |  |
| | 3,4-Diethoxyphenethylamine Chemical Properties |
| Boiling point | 162 °C(Press: 13 Torr) | | density | 1.0366 g/cm3(Temp: 25 °C) | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | 9.75±0.10(Predicted) | | form | Oil | | color | Pale Yellow to Yellow | | InChI | InChI=1S/C12H19NO2/c1-3-14-11-6-5-10(7-8-13)9-12(11)15-4-2/h5-6,9H,3-4,7-8,13H2,1-2H3 | | InChIKey | YOUNXJAJHCCMNK-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(OCC)C(OCC)=C1 | | CAS DataBase Reference | 61381-04-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 3,4-Diethoxyphenethylamine Usage And Synthesis |
| Uses | 2-(3,4-Diethoxyphenyl)ethanamine is a useful intermediate in the preparation of Drotaverine hydrochloride, an antispasmodic drug arising from papaverine class of biologically active compounds. |
| | 3,4-Diethoxyphenethylamine Preparation Products And Raw materials |
|