|
|
| | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride Basic information |
| Product Name: | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride | | Synonyms: | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride;2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide hydrochloride (1:1);N-(2,5-Dimethylphenyl)-N2,N2-diethylglycinamide hydrochloride (1:1);Lidocaine EP Impurity J HCl;USP Lidocaine impurity J;Lidocaine impurity 14/Lidocaine EP Impurity J HCl/Lidocaine 2,5-Dimethyl Analog HCl/2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide Hydrochloride;Lidocaine Impurity J(EP);Lidocaine-014-HCl | | CAS: | 1012864-23-1 | | MF: | C14H23ClN2O | | MW: | 270.79822 | | EINECS: | | | Product Categories: | Amines, Aromatics, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 1012864-23-1.mol |  |
| | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride Chemical Properties |
| Melting point | 130-132 °C(Solv: acetone (67-64-1)) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C14H22N2O.ClH/c1-5-16(6-2)10-14(17)15-13-9-11(3)7-8-12(13)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H | | InChIKey | HPSKXAHVFGEADX-UHFFFAOYSA-N | | SMILES | c1c(NC(CN(CC)CC)=O)c(C)ccc1C.Cl |
| | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride Usage And Synthesis |
| Uses | 2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide Hydrochloride is an impurity in the synthesis of Lidocaine Hydrochloride (L397800), an anesthetic local agent and antiarrythmic class IB agent. | | Uses | 2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide Hydrochloride is an mpurity in the synthesis of Lidocaine Hydrochloride (L397800), an anesthetic local agent and antiarrythmic class IB agent. |
| | 2-(DiethylaMino)-N-(2,5-diMethylphenyl)acetaMide Hydrochloride Preparation Products And Raw materials |
|