|
|
| | METHYL 2-METHYL-3-FUROATE Basic information |
| | METHYL 2-METHYL-3-FUROATE Chemical Properties |
| Boiling point | 75 °C20 mm Hg(lit.) | | density | 1.116 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.473(lit.) | | Fp | 147 °F | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 1342040 | | InChI | InChI=1S/C7H8O3/c1-5-6(3-4-10-5)7(8)9-2/h3-4H,1-2H3 | | InChIKey | UVRRIABXNIGUJZ-UHFFFAOYSA-N | | SMILES | O1C=CC(C(OC)=O)=C1C | | LogP | 1.730 (est) | | CAS DataBase Reference | 6141-58-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29321900 | | Storage Class | 10 - Combustible liquids |
| | METHYL 2-METHYL-3-FUROATE Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW TO BROWN LIQUID | | Uses | Methyl 2-methyl-3-furoate is a useful building block used in a variety of synthetic applications, such as the nickel-catalyzed amide bond formation from methyl esters, and gold-catalyzed arylation by arylsilanes. |
| | METHYL 2-METHYL-3-FUROATE Preparation Products And Raw materials |
| Raw materials | β-D-ribo-Hexopyranoside, (2R,3R,4aR,5R,6R)-5-(carboxymethyl)-1,2,3,4,4a,5,6,7-octahydro-3-hydroxy-4a-methyl-6-[[(2-methyl-3-furanyl)carbonyl]oxy]-2-naphthalenyl O-2,6-dideoxy-3-O-methyl-β-D-ribo-hexopyranosyl-(1→4)-O-2,6-dideoxy-3-O-methyl-α-L-lyxo-hexopyranosyl-(1→4)-2,6-dideoxy-3-O-methyl--->Spiro[cyclopropane-1,2'-[7]oxabicyclo[2.2.1]hept[5]ene]-6'-carboxylic acid, 1'-methyl-3'-oxo-, methyl ester-->Methyl 2-diazo-3-oxobutanoate-->5-(acetyloxy)-4,5-dihydro-2-methyl-3-Furancarboxylic acid, methyl ester-->2-METHYL-3-FUROIC ACID-->Chloroacetaldehyde-->Methanol-->Vinyl acetate-->Methyl acetoacetate-->Ethyl vinyl ether | | Preparation Products | METHYL 5-FORMYL-2-METHYL-3-FUROATE |
|