| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Coumestrol dimethylether
CAS:3172-99-4
Purity:HPLC>=98% Package:10mg Remarks:B27520
|
| Company Name: |
SHANGHAI ZZBIO CO., LTD.
|
| Tel: |
15102117276 19921389125 |
| Email: |
tech@zzbioco.com |
| Products Intro: |
Product Name:Coumestrol dimethylether
CAS:3172-99-4
Purity:>=98% (HPLC) Package:10mg
|
| Company Name: |
Chengdu Peter-like Biotechnology Co., Ltd.
|
| Tel: |
028-81700200 13308200041 |
| Email: |
2851167782@qq.com |
| Products Intro: |
Product Name:Coumestrol dimethyl ether
CAS:3172-99-4
Purity:HPLC>=98% 现货 Package:5mg10mg20mg50mg100mg500mg1g2g等应客户需求包装
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Coumestrol dimethyl ether
CAS:3172-99-4
|
|
| | 3,9-DI-O-METHYLCOUMESTROL Basic information |
| Product Name: | 3,9-DI-O-METHYLCOUMESTROL | | Synonyms: | 3,9-DI-O-METHYLCOUMESTROL;AURORA KA-4773;COUMESTROL DIMETHYL ETHER;COUMESTROL DIMETHYL ETHER, FOR FLUORESCE;3,9-Di-o-methylcoumesterol;7,12-dimethoxy-coumestan;3,9-Dimethoxy-6H-benzofuro[3,2-c][1]benzopyran-6-one;6H-Benzofuro[3,2-c][1]benzopyran-6-one, 3,9-dimethoxy- | | CAS: | 3172-99-4 | | MF: | C17H12O5 | | MW: | 296.27 | | EINECS: | | | Product Categories: | | | Mol File: | 3172-99-4.mol |  |
| | 3,9-DI-O-METHYLCOUMESTROL Chemical Properties |
| Melting point | 197 °C | | Boiling point | 486.1±35.0 °C(Predicted) | | density | 1.355±0.06 g/cm3(Predicted) | | solubility | DMSO: soluble | | form | powder | | BRN | 286103 | | InChI | 1S/C17H12O5/c1-19-9-3-5-11-13(7-9)21-16-12-6-4-10(20-2)8-14(12)22-17(18)15(11)16/h3-8H,1-2H3 | | InChIKey | PXHLPCBBXPHBHP-UHFFFAOYSA-N | | SMILES | COc1ccc-2c(OC(=O)c3c-2oc4cc(OC)ccc34)c1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,9-DI-O-METHYLCOUMESTROL Usage And Synthesis |
| Uses | Coumestrol dimethyl ether is a biochemical suitable for fluorescence. |
| | 3,9-DI-O-METHYLCOUMESTROL Preparation Products And Raw materials |
|