- DL-5-Methoxytryptophan
-
- $0.00 / 10G
-
2026-01-26
- CAS:28052-84-8
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | 5-METHOXY-DL-TRYPTOPHAN Basic information |
| | 5-METHOXY-DL-TRYPTOPHAN Chemical Properties |
| Melting point | 258-261 °C (dec.)(lit.) | | Boiling point | 376.57°C (rough estimate) | | density | 1.1923 (rough estimate) | | refractive index | 1.6660 (estimate) | | storage temp. | -20°C | | solubility | DMSO: 1 mg/ml; PBS (pH 7.2): 1 mg/ml | | form | crystalline | | color | Light yellow to yellow | | BRN | 26781 | | Major Application | peptide synthesis | | InChI | 1S/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16) | | InChIKey | KVNPSKDDJARYKK-UHFFFAOYSA-N | | SMILES | COc1ccc2[nH]cc(CC(N)C(O)=O)c2c1 | | CAS DataBase Reference | 28052-84-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 5-METHOXY-DL-TRYPTOPHAN Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 5-Methoxy-DL-tryptophan is a molecule produced by endothelial cells to modulate inflammatory responses and protect against systemic inflammation. It can also suppress lipopolysaccharide-induced inflammatory responses and signaling in macrophages and endotoxemic lung tissues. | | Definition | ChEBI: 5-Methoxy-DL-tryptophan is a member of tryptamines. It is functionally related to a serotonin. | | Biochem/physiol Actions | 5-Methoxy-DL-tryptophan is an amino acid derivative. | | in vivo | 5-Methoxy-DL-tryptophan (23.5 mg/kg, i.p., twice a week, 12-20 weeks) attenuates ARS staining of the aortic arch region in a mouse model of atherosclerosis and atherosclerotic calcification[1].
| | IC 50 | IL-6 |
| | 5-METHOXY-DL-TRYPTOPHAN Preparation Products And Raw materials |
|