| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
1,1'-Diethyl-2,2'-carbocyanine iodide manufacturers
|
| | 1,1'-Diethyl-2,2'-carbocyanine iodide Basic information |
| | 1,1'-Diethyl-2,2'-carbocyanine iodide Chemical Properties |
| Melting point | 295 °C (dec.)(lit.) | | storage temp. | 2-8°C | | solubility | ethanol: 10mg/mL | | form | powder to crystal | | color | Green to Dark green | | λmax | 614 nm | | ε(extinction coefficient) | ≥180000 at 602-608nm in ethanol
≥80000 at 560-566nm in ethanol | | BRN | 4117070 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C25H25N2.HI/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 | | InChIKey | QWYZFXLSWMXLDM-UHFFFAOYSA-M | | SMILES | [I-].CCN1\C(=C\C=C\c2ccc3ccccc3[n+]2CC)C=Cc4ccccc14 | | CAS DataBase Reference | 605-91-4(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 23/24/25 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | VC3676870 | | HS Code | 2933.49.7000 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral |
| | 1,1'-Diethyl-2,2'-carbocyanine iodide Usage And Synthesis |
| Uses | Diagnostic aid (obstetrics). | | Uses | The fluorescence decay time of pinacyanol (1,1-diethyl-2,2-carbocyanine) iodide has been measured in the temperature range 95-225 K. | | Definition | ChEBI: Pinacyanol iodide is a cyanine dye and an organic iodide salt. It has a role as a fluorochrome. It contains a pinacyanol cation. |
| | 1,1'-Diethyl-2,2'-carbocyanine iodide Preparation Products And Raw materials |
|