|
|
| | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate | | Synonyms: | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate;tert-butyl 4-(1-piperazinylmethyl)-1-piperidinecarboxylate;1-Piperidinecarboxylic acid, 4-(1-piperazinylmethyl)-, 1,1-dimethylethyl ester;1-Boc-4-(piperazin-1-ylmethyl)piperidine;4-(piperazin-1-ylmethyl)piperidine-1-carboxylate | | CAS: | 381722-48-1 | | MF: | C15H29N3O2 | | MW: | 283.41 | | EINECS: | | | Product Categories: | | | Mol File: | 381722-48-1.mol |  |
| | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 386.3±17.0 °C(Predicted) | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 9.22±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C15H29N3O2/c1-15(2,3)20-14(19)18-8-4-13(5-9-18)12-17-10-6-16-7-11-17/h13,16H,4-12H2,1-3H3 | | InChIKey | UYZVZLYOXDJHPR-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CN2CCNCC2)CC1 |
| | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 4-((piperazin-1-yl)methyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|