| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Acetamido-2-methylacetophenone Basic information |
| Product Name: | 4-Acetamido-2-methylacetophenone | | Synonyms: | N-(4-ACETYL-3-METHYLPHENYL)ACETAMIDE;N-ACETYL-4-ACETYL-3-METHYLANILINE;N-(4-Acetyl-3-methylphenyl)acetamide, 4-Acetyl-3-methylacetanilide, 1-[4-(Acetylamino)-2-methylphenyl]ethan-1-one;4'-Acetamido-2'-methylacetophenone >;Acetamide, N-(4-acetyl-3-methylphenyl)-;4'-Acetamido-2'-methylacetophenone;4′-Acetamido-2′-methylacetophenone, CAS 34956-31-5;4-Acetamido-2-methylacetophenone | | CAS: | 34956-31-5 | | MF: | C11H13NO2 | | MW: | 191.23 | | EINECS: | 233-305-4 | | Product Categories: | Aromatic Acetophenones & Derivatives (substituted) | | Mol File: | 34956-31-5.mol |  |
| | 4-Acetamido-2-methylacetophenone Chemical Properties |
| Melting point | 137-140 °C(lit.) | | Boiling point | 385℃ | | density | 1.122 | | Fp | 167℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.60±0.70(Predicted) | | color | White to Light yellow | | InChI | 1S/C11H13NO2/c1-7-6-10(12-9(3)14)4-5-11(7)8(2)13/h4-6H,1-3H3,(H,12,14) | | InChIKey | PTARWPNYVATTDE-UHFFFAOYSA-N | | SMILES | CC(=O)Nc1ccc(C(C)=O)c(C)c1 | | CAS DataBase Reference | 34956-31-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | 4-Acetamido-2-methylacetophenone Usage And Synthesis |
| Uses | 4′-Acetamido-2′-methylacetophenone may be used in the preparation of 4-amino-2-methylacetophenone by acid hydrolysis. | | General Description | 4′-Acetamido-2′-methylacetophenone (4-acetamido-2-methylacetophenone) can be prepared by treating m-methylacetanilide with acetyl chloride in the presence of aluminum chloride in carbon disulfide. |
| | 4-Acetamido-2-methylacetophenone Preparation Products And Raw materials |
|