| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-1-Benzyl-2,2-diphenylethylamine Basic information |
| | (R)-(+)-1-Benzyl-2,2-diphenylethylamine Chemical Properties |
| Melting point | 74-78 °C (lit.) | | Boiling point | 418.891±14.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.075±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 8.469±0.13(predicted) | | form | solid | | Optical Rotation | [α]20/D +8.0°, c = 1% in chloroform | | InChI | 1S/C21H21N/c22-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-21H,16,22H2/t20-/m1/s1 | | InChIKey | HPRWGZYKYRRJNU-HXUWFJFHSA-N | | SMILES | N[C@H](Cc1ccccc1)C(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922390090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-1-Benzyl-2,2-diphenylethylamine Usage And Synthesis |
| | (R)-(+)-1-Benzyl-2,2-diphenylethylamine Preparation Products And Raw materials |
|