| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol Basic information |
| Product Name: | (R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol | | Synonyms: | (R)-2-Amino-1,1,3-triphenyl-1-propanol,99%e.e.;(2R)-1,1,3-Triphenyl-2-amino-1-propanol;Benzenepropanol, β-amino-α,α-diphenyl-, (βR)-;(R)-(+)-2-AMINO-1,1,3-TRIPHENYL-1-PROPANOL USP/EP/BP;(R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol;(R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol | | CAS: | 86906-05-0 | | MF: | C21H21NO | | MW: | 303.4 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 86906-05-0.mol |  |
| | (R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol Chemical Properties |
| Melting point | 142-144 °C(lit.) | | Boiling point | 502.261±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.145±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 11.225±0.50(predicted) | | Optical Rotation | [α]20/D +85°, c = 1 in chloroform | | InChI | 1S/C21H21NO/c22-20(16-17-10-4-1-5-11-17)21(23,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,23H,16,22H2/t20-/m1/s1 | | InChIKey | KBXBDYRXZGBOIH-HXUWFJFHSA-N | | SMILES | N[C@H](Cc1ccccc1)C(O)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2922190090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol Usage And Synthesis |
| | (R)-(+)-2-Amino-1,1,3-triphenyl-1-propanol Preparation Products And Raw materials |
|