| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
[4-(1,2,2-triphenylethenyl)phenyl]boronic acid manufacturers
|
| | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid Basic information |
| Product Name: | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid | | Synonyms: | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid;4-(1,2,2-triphenylvinyl)phenylboronic acid;B-[4-(1,2,2-Triphenylethenyl)phenyl]boronic acid;Boronic acid, B-[4-(1,2,2-triphenylethenyl)phenyl]-;2-triphenylethenyl)phenyl]boronic acid;[4-(Triphenylvinyl)phenyl]boronic acid;1,2,2-Triphenylethenyl-(4'-phenylene) boronic acid;B-[4-(1,2,2-Triphenylethenyl)phenyl]boronic acid(Contains varying amounts of anhydride) | | CAS: | 1227040-87-0 | | MF: | C26H21BO2 | | MW: | 376.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1227040-87-0.mol | ![[4-(1,2,2-triphenylethenyl)phenyl]boronic acid Structure](CAS/20180702/GIF/1227040-87-0.gif) |
| | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid Chemical Properties |
| Melting point | 126-131°C | | Boiling point | 513.2±60.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.65±0.16(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C26H21BO2/c28-27(29)24-18-16-23(17-19-24)26(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19,28-29H | | InChIKey | XSIVQWOJIOHPIZ-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1)(O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid Usage And Synthesis |
| | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid Preparation Products And Raw materials |
|