| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene Basic information | | Uses |
| Product Name: | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene | | Synonyms: | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene;[4-(Triphenylvinyl)phenyl]boronic acid pinacol ester;1-(4-phenylboronic acid pinacol ester)-1,2,2-triphenyle;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-(1,2,2-triphenylethenyl)phenyl]-;1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene ISO 9001：2015 REACH;4,4,5,5-tetramethyl-2-[4-(1,2,2-triphenylethenyl)phenyl]-1,3,2-dioxaborolane;4-(1,2,2-Triphenylvinyl)phenylboronic Acid Pinacol Ester;1-(4-phenylboronic acid pinacol ester)-1,2,2-tristyrene | | CAS: | 1260865-91-5 | | MF: | C32H31BO2 | | MW: | 458.4 | | EINECS: | | | Product Categories: | | | Mol File: | 1260865-91-5.mol |  |
| | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene Chemical Properties |
| Boiling point | 536.6±29.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C32H31BO2/c1-31(2)32(3,4)35-33(34-31)28-22-20-27(21-23-28)30(26-18-12-7-13-19-26)29(24-14-8-5-9-15-24)25-16-10-6-11-17-25/h5-23H,1-4H3 | | InChIKey | XIPGCKFASRXQSN-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene Usage And Synthesis |
| Uses | 1-(4-Pinnayl phenylboronic acid)-1,2,2-triphenylene is a hydrocarbon derivative that can be used as an intermediate in the synthesis of materials. |
| | 1-(4-Phenylboronic acid pinacol ester)-1,2,2-triphenylethene Preparation Products And Raw materials |
|