(2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene manufacturers
|
| | (2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene Basic information |
| Product Name: | (2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene | | Synonyms: | (2-(4-ethynylphenyl) ethane-1,1,2-triyl)tribenzene;1-Ethinyl-4-(triphenylvinyl)benzol;(2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene;Benzene, 1-ethynyl-4-(1,2,2-triphenylethenyl)-;1-Ethynyl-4-(1,2,2-triphenylethenyl)benzene;(2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene ISO 9001：2015 REACH;(2-(4-Ethynylphenyl)ethene-1,1,2-triyl)tribenzene - [E88648] | | CAS: | 1225493-18-4 | | MF: | C28H20 | | MW: | 356.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1225493-18-4.mol |  |
| | (2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene Chemical Properties |
| Boiling point | 451.5±24.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | organic solvents: soluble (THF, DCM, DMF, DMSO) | | form | powder or crystals | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C28H20/c1-2-22-18-20-26(21-19-22)28(25-16-10-5-11-17-25)27(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h1,3-21H | | InChIKey | FAHRYGJKAWVULP-UHFFFAOYSA-N | | SMILES | C1(C#C)=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene Usage And Synthesis |
| Uses | AIE (aggregation-induced emission)-active building block. |
| | (2-(4-ethynylphenyl)ethene-1,1,2-triyl)tribenzene Preparation Products And Raw materials |
|