|
|
| | 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene Basic information |
| Product Name: | 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene | | Synonyms: | (2S,3R,4R,5S,6R)-2-(3-((5-(2-fluorophenyl)thiophen-2-yl)methyl)-4- methylphenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol;Dapagliflozin-20;Canagliflozin impurity 1/4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene;Benzene, 4-bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]-;4-Bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]benzene;4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene? (Dapagliflozin Impurity）;Dapagliflozin Impurity 2Q: What is
Dapagliflozin Impurity 2 Q: What is the CAS Number of
Dapagliflozin Impurity 2 Q: What is the storage condition of
Dapagliflozin Impurity 2 Q: What are the applications of
Dapagliflozin Impurity 2;Dapagliflozin Impurity 19 | | CAS: | 1830346-16-1 | | MF: | C15H14BrClO | | MW: | 325.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1830346-16-1.mol |  |
| | 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene Chemical Properties |
| Boiling point | 382.9±32.0 °C(Predicted) | | density | 1.371±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H14BrClO/c1-2-18-15-6-4-3-5-11(15)9-12-10-13(16)7-8-14(12)17/h3-8,10H,2,9H2,1H3 | | InChIKey | OJDCRWLGJWSFFT-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(Br)C=C1CC1=CC=CC=C1OCC |
| | 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene Usage And Synthesis |
| Uses | 4-Bromo-1-chloro-2-[(2-ethoxyphenyl)methyl]benzene, is an impurity of Dapagliflozin (D185370), a sodium-glucose transporter 2 inhibitor. |
| | 4-bromo-1-chloro-2-(2-ethoxybenzyl)benzene Preparation Products And Raw materials |
|