| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
cis-10-Heptadecenoic acid methyl ester manufacturers
|
| | cis-10-Heptadecenoic acid methyl ester Basic information |
| | cis-10-Heptadecenoic acid methyl ester Chemical Properties |
| Boiling point | 353.1±11.0 °C(Predicted) | | density | 0.875±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform: soluble; Hexane: soluble | | form | liquid | | InChI | 1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-2/h8-9H,3-7,10-17H2,1-2H3/b9-8- | | InChIKey | JNSUZRHLHDQGPN-HJWRWDBZSA-N | | SMILES | CCCCCC\C=C/CCCCCCCCC(=O)OC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | cis-10-Heptadecenoic acid methyl ester Usage And Synthesis |
| Uses | (10Z)-10-Heptadecenoic Acid Methyl Ester is a component of blackberry seed oil with antioxidant activity. It also suppresses allergic inflammation in human basophilic KU812F cells. | | Definition | ChEBI: Methyl cis-10-heptadecenoate is a fatty acid methyl ester. |
| | cis-10-Heptadecenoic acid methyl ester Preparation Products And Raw materials |
|