| Company Name: |
China Langchem Inc. Gold |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
|
| | 2-Bromo-4-thiazolecarboxylic acid Basic information | | Uses |
| | 2-Bromo-4-thiazolecarboxylic acid Chemical Properties |
| Melting point | 212-214 | | Boiling point | 350.0±15.0 °C(Predicted) | | density | 2.062±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 3.13±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | λmax | 243nm(MeOH)(lit.) | | InChI | InChI=1S/C4H2BrNO2S/c5-4-6-2(1-9-4)3(7)8/h1H,(H,7,8) | | InChIKey | BEGREHRAUWCAHV-UHFFFAOYSA-N | | SMILES | S1C=C(C(O)=O)N=C1Br | | CAS DataBase Reference | 5198-88-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29341000 | | Storage Class | 11 - Combustible Solids |
| | 2-Bromo-4-thiazolecarboxylic acid Usage And Synthesis |
| Uses | Thiazole compounds are important pharmaceutical and chemical intermediates, characterized by low toxicity, excellent biological activities (such as acaricidal, bactericidal, and inhibitory effects on insect pheromone synthesis), and diverse structural variations. Thiazole 2-bromo-4-thiazolium carboxylic acid is a key intermediate in the synthesis of thiabendazole. | | Chemical Properties | Pale yellow crystals | | Synthesis | Ethyl 2-aminothiazole-4-carboxylate was synthesized solvent-free from thiourea and ethyl bromopyruvate as reagent, then ethyl 2-bromothiazole-4-carboxylate was obtained by high-temperature diazotization with DM SO and sodium nitrite, and finally the target 2-bromo-4-thiazolecarboxylate was obtained by saponification with potassium carbonate-methanol solution . |
| | 2-Bromo-4-thiazolecarboxylic acid Preparation Products And Raw materials |
|