2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester manufacturers
|
| | 2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester Basic information |
| Product Name: | 2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester | | Synonyms: | ethyl 2,5-dibromooxazole-4-carboxylate;2,5-Dibromo-4-(ethoxycarbonyl)-1,3-thiazole;Ethyl 2,5-dibromo-4-thiazolecarboxylate;2,5-DIBROMO-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTE;2,5-Dibromothiazole-4-carboxylic acid ethyl;naphthalene-2,7-diyl diacetate;2,5-dibromo-1,3-thiazoL;4-Thiazolecarboxylic acid, 2,5-dibromo-, ethyl ester | | CAS: | 208264-60-2 | | MF: | C6H5Br2NO2S | | MW: | 314.98 | | EINECS: | | | Product Categories: | | | Mol File: | 208264-60-2.mol |  |
| | 2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester Chemical Properties |
| density | 1.982 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | Off-white to yellow Solid | | InChI | 1S/C6H5Br2NO2S/c1-2-11-5(10)3-4(7)12-6(8)9-3/h2H2,1H3 | | InChIKey | SAEIBOLCDWLABF-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=C(Br)SC(Br)=N1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | 2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester Usage And Synthesis |
| | 2,5-Dibromo-thiazole-4-carboxylic acid ethyl ester Preparation Products And Raw materials |
|