| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Dde Biotin-PEG4-Picolyl Azide manufacturers
|
| | Dde Biotin-PEG4-Picolyl Azide Basic information |
| | Dde Biotin-PEG4-Picolyl Azide Chemical Properties |
| storage temp. | -20°C | | form | solid | | InChIKey | CYXSXYDLWXHYSI-JKMQWNNCSA-N | | SMILES | S1[C@@H]([C@@H]4NC(=O)N[C@@H]4C1)CCCCC(=O)NCCOCCOCCOCCOCCC(=C3C(=O)CC(CC3=O)(C)C)NCCC(=O)Nc2cnc(cc2)CN=[N+]=[N-] |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Dde Biotin-PEG4-Picolyl Azide Usage And Synthesis |
| Description | Dde Biotin-PEG4-Picolyl azide is a cleavable biotin reagent containing a picolyl azide moiety which can be conjugated with alkyne-containing biomolecules. This biotin reagent incorporates a copper-chelating motif that dramatically accelerates the Cu(I)-catalyzed Click Chemistry. The hydrophilic spacer arm provides better solubility to the labeled molecules in aqueous media. Dde protecting group allows efficient release of captured biotinylated molecules from streptavidin under mild conditions with hydrazine. | | Uses | Dde biotin picolyl azide is a unique alkyne-reactive, cleavable biotin probe that allows for release of the captured biomolecules from streptavidin under mild conditions. This reagent contains a biotin moiety linked to a picolyl azide moiety through a spacer arm containing a hydrazine-cleavable Dde moiety. Captured biomolecules can be efficiently released, typically >90% with 2% hydrazine in aqueous media.
Dde biotin picolyl azide incorporates a copper-chelating motif that dramatically accelerates the Cu(I)-catalyzed azide-alkyne cycloaddition (CuAAC) reaction under conditions relevant to biomolecular labeling. Discovery of azides with an internal Cu(I)-chelating motif greatly enhances the utility of the CuAAC reaction for various applications. Some examples are monitoring the dynamic glycan biosynthesis in living organisms; sensitive detection of metabolically-labeled proteins, DNAs, and RNAs; and many other applications where rate acceleration and reduced cell toxicity are highly desirable. | | reaction suitability | reaction type: click chemistry | | IC 50 | PEGs |
| | Dde Biotin-PEG4-Picolyl Azide Preparation Products And Raw materials |
|