| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Diazo Biotin-PEG3-Alkyne manufacturers
|
| | Diazo Biotin-PEG3-Alkyne Basic information |
| Product Name: | Diazo Biotin-PEG3-Alkyne | | Synonyms: | Diazo Biotin-PEG3-Alkyne;1H-Thieno[3,4-d]imidazole-4-pentanamide, hexahydro-N-[1-[4-[2-[2-hydroxy-5-[2-[[1-oxo-3-(2-propyn-1-yloxy)propyl]amino]ethyl]phenyl]diazenyl]phenyl]-1-oxo-5,8,11-trioxa-2-azatridec-13-yl]-2-oxo-, (3aS,4S,6aR)-;Diazo Biotin-PEG3-Propargy | | CAS: | 1884349-58-9 | | MF: | C39H53N7O9S | | MW: | 795.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1884349-58-9.mol |  |
| | Diazo Biotin-PEG3-Alkyne Chemical Properties |
| Boiling point | 1092.2±65.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | pka | 8.48±0.45(Predicted) | | form | solid | | color | Orange to reddish brown | | InChIKey | AIUZFZDETVBCLH-AXGBYHFGSA-N | | SMILES | S1[C@H]([C@H]4NC(=O)N[C@H]4C1)CCCCC(=O)NCCOCCOCCOCCNC(=O)c2ccc(cc2)\N=N\c3c(ccc(c3)CCNC(=O)CCOCC#C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Diazo Biotin-PEG3-Alkyne Usage And Synthesis |
| Description | Diazo Biotin-PEG3-alkyne is useful for introducing a biotin moiety to azide-containing biomolecules using Cu(I)-catalyzed Click Chemistry. The hydrophilic spacer arm provides better solubility to the labeled molecules in aqueous media. Diazo allows efficient release of captured biotinylated molecules from streptavidin using sodium dithionite (Na2S2O4). | | Uses | Diazo biotin-alkyne is an alkyne-activated, sodium dithionite (Na2S2O4) cleavable biotin probe that allows for efficient release of the captured biomolecules from streptavidin. This reagent contains a biotin moiety linked to an azide group through a spacer arm containing a diazo group that can be cleaved with 50 mM sodium dithionite solution. | | IC 50 | PEGs |
| | Diazo Biotin-PEG3-Alkyne Preparation Products And Raw materials |
|