| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Piperidine-d11 Basic information |
| | Piperidine-d11 Chemical Properties |
| Melting point | -13 °C (lit.) | | Boiling point | 106 °C (lit.) | | density | 0.973 g/mL at 25 °C | | refractive index | n20/D 1.448(lit.) | | Fp | 40 °F | | InChI | InChI=1S/C5H11N/c1-2-4-6-5-3-1/h6H,1-5H2 | | InChIKey | NQRYJNQNLNOLGT-UHFFFAOYSA-N | | SMILES | C1([H])([H])C([H])([H])C([H])([H])N([H])C([H])([H])C1([H])[H] | | CAS Number Unlabeled | 110-89-4 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24-34 | | Safety Statements | 16-26-27-45 | | RIDADR | UN 2401 8/PG 1 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |
| | Piperidine-d11 Usage And Synthesis |
| Uses | Labeled PIPERIDINE-D11, intended for use as an internal standard for the quantification of piperidine by GC- or LC-mass spectrometry. |
| | Piperidine-d11 Preparation Products And Raw materials |
|