|
|
| | BOC-(S)-3-AMINO-5-HEXYNOIC ACID Basic information |
| | BOC-(S)-3-AMINO-5-HEXYNOIC ACID Chemical Properties |
| Boiling point | 386.7±37.0 °C(Predicted) | | density | 1.129 | | form | lumps | | pka | 4.31±0.10(Predicted) | | Optical Rotation | [α]/D +26±2°, c = 1 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C11H17NO4/c1-5-6-8(7-9(13)14)12-10(15)16-11(2,3)4/h1,8H,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | QZRLAJLEZVWLOV-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC#C)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral |
| | BOC-(S)-3-AMINO-5-HEXYNOIC ACID Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: click chemistry |
| | BOC-(S)-3-AMINO-5-HEXYNOIC ACID Preparation Products And Raw materials |
|