|
|
| | 2,6-Dichloropyridine-4-carboxaldehyde Basic information |
| | 2,6-Dichloropyridine-4-carboxaldehyde Chemical Properties |
| Melting point | 44-48 °C | | Boiling point | 276.7±35.0 °C(Predicted) | | density | 1.488±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -4.39±0.10(Predicted) | | form | crystalline solid | | color | Yellow | | InChI | InChI=1S/C6H3Cl2NO/c7-5-1-4(3-10)2-6(8)9-5/h1-3H | | InChIKey | MVCMPKYZHKUBCL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC(C=O)=C1 | | CAS DataBase Reference | 113293-70-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 2,6-Dichloropyridine-4-carboxaldehyde Usage And Synthesis |
| Chemical Properties | White to yellow solid |
| | 2,6-Dichloropyridine-4-carboxaldehyde Preparation Products And Raw materials |
|