| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | p-Nitrophenyl nonyl ether Basic information |
| Product Name: | p-Nitrophenyl nonyl ether | | Synonyms: | 1-(4-NITROPHENOXY)NONANE;4-NITROPHENYL NONYL ETHER;1-Nitro-4-(nonyloxy)benzene;Benzene, 1-nitro-4-(nonyloxy)-;TIMTEC-BB SBB008291;P-NONYLOXYNITROBENZENE;p-Nitrophenyl nonyl ether | | CAS: | 86702-46-7 | | MF: | C15H23NO3 | | MW: | 265.35 | | EINECS: | | | Product Categories: | | | Mol File: | 86702-46-7.mol |  |
| | p-Nitrophenyl nonyl ether Chemical Properties |
| Boiling point | 188-189 °C/7 mmHg (lit.) | | density | 1.029 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.525(lit.) | | Fp | >230 °F | | Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. | | InChI | 1S/C15H23NO3/c1-2-3-4-5-6-7-8-13-19-15-11-9-14(10-12-15)16(17)18/h9-12H,2-8,13H2,1H3 | | InChIKey | JLSCIQUWVGKSDH-UHFFFAOYSA-N | | SMILES | CCCCCCCCCOc1ccc(cc1)[N+]([O-])=O |
| | p-Nitrophenyl nonyl ether Usage And Synthesis |
| | p-Nitrophenyl nonyl ether Preparation Products And Raw materials |
|