| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
S-Octylglutathione manufacturers
|
| | S-Octylglutathione Basic information |
| | S-Octylglutathione Chemical Properties |
| Boiling point | 752.147±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.215±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.214±0.10(predicted) | | InChI | 1S/C18H33N3O6S/c1-2-3-4-5-6-7-10-28-12-14(17(25)20-11-16(23)24)21-15(22)9-8-13(19)18(26)27/h13-14H,2-12,19H2,1H3,(H,20,25)(H,21,22)(H,23,24)(H,26,27) | | InChIKey | MJWCZWAVSJZQNL-UHFFFAOYSA-N | | SMILES | CCCCCCCCSCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S-Octylglutathione Usage And Synthesis |
| Uses | S-Octylglutathione is a competitive glutathione S-transferase (GST) inhibitor[1]. | | Biochem/physiol Actions | S-octylglutathione is a competitive inhibitor for glutathione S-transferases. | | References | [1] Andújar-Sánchez M, et al. Crystallographic and thermodynamic analysis of the binding of S-octylglutathione to the Tyr 7 to Phe mutant of glutathione S-transferase from Schistosoma japonicum. Biochemistry. 2005 Feb 1;44(4):1174-83. DOI:10.1021/bi0483110 |
| | S-Octylglutathione Preparation Products And Raw materials |
|