|
|
| | S-Methylglutathione Basic information |
| Product Name: | S-Methylglutathione | | Synonyms: | S-methyl-GSH;2-Amino-5-((1-((carboxymethyl)amino)-3-(methylthio)-1-oxopropan-2-yl)amino)-5-oxopentanoic acid;L-γGlu-S-Methyl-L-Cys-Gly-OH;γGlu-3-(Methylthio)-Ala-Gly-OH;(2S)-2-amino-5-[[(1R)-2-(carboxymethylamino)-2-keto-1-[(methylthio)methyl]ethyl]amino]-5-keto-valeric acid;(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-methylsulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid;(2S)-2-azanyl-5-[[(2R)-1-(carboxymethylamino)-3-methylsulfanyl-1-oxo-propan-2-yl]amino]-5-oxo-pentanoic acid;Glycine, L-γ-glutamyl-S-methyl-L-cysteinyl- | | CAS: | 2922-56-7 | | MF: | C11H19N3O6S | | MW: | 321.35 | | EINECS: | | | Product Categories: | Dipeptides and Tripeptides;Glutathione and Derivatives;Peptides | | Mol File: | 2922-56-7.mol |  |
| | S-Methylglutathione Chemical Properties |
| Boiling point | 765.1±60.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.21±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | Water: 35.71 mg/mL (111.12 mM) | | InChI | 1S/C11H19N3O6S/c1-21-5-7(10(18)13-4-9(16)17)14-8(15)3-2-6(12)11(19)20/h6-7H,2-5,12H2,1H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20) | | InChIKey | QTQDDTSVRVWHMO-UHFFFAOYSA-N | | SMILES | CSCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S-Methylglutathione Usage And Synthesis |
| Uses | S-methylglutathione is a methionine containing peptide and glyoxylase inhibitor. | | Definition | ChEBI: S-methylglutathione is an S-substituted glutathione that is glutathione in which the mercapto hydrogen has been replaced by a methyl group. It is a S-substituted glutathione and a methyl sulfide. It is a tautomer of a S-methylglutathione zwitterion. | | Biochem/physiol Actions | S-methylglutathione is a methionine containing peptide and glyoxylase inhibitor. |
| | S-Methylglutathione Preparation Products And Raw materials |
|