| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Cyano-7-hydroxy-4-methylcoumarin Basic information |
| | 3-Cyano-7-hydroxy-4-methylcoumarin Chemical Properties |
| Melting point | 300-304 °C (lit.) | | Boiling point | 429.7±45.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | pka | 7.14±0.20(Predicted) | | InChI | 1S/C11H7NO3/c1-6-8-3-2-7(13)4-10(8)15-11(14)9(6)5-12/h2-4,13H,1H3 | | InChIKey | GLGBPOSQDAZSIZ-UHFFFAOYSA-N | | SMILES | CC1=C(C#N)C(=O)Oc2cc(O)ccc12 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Cyano-7-hydroxy-4-methylcoumarin Usage And Synthesis |
| Uses | 3-Cyano-7-hydroxy-4-methylcoumarin (CHMC) may be used as reagent for the stereo-specific preparation of RP- and SP-O-alkyl methylphosphonyl-CHMC esters. | | General Description | 3-Cyano-7-hydroxy-4-methylcoumarin has been isolated from Curcuma longa isopropanol extract. |
| | 3-Cyano-7-hydroxy-4-methylcoumarin Preparation Products And Raw materials |
|