|
|
| | 2,5-DIBROMOPYRIDINE-3-BORONIC ACID Basic information |
| | 2,5-DIBROMOPYRIDINE-3-BORONIC ACID Chemical Properties |
| Melting point | 206 °C | | Boiling point | 406.4±55.0 °C(Predicted) | | density | 2.22±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 5.63±0.58(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4BBr2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H | | InChIKey | CBWWZYPUCZRZGD-UHFFFAOYSA-N | | SMILES | B(C1=CC(Br)=CN=C1Br)(O)O |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2,5-DIBROMOPYRIDINE-3-BORONIC ACID Usage And Synthesis |
| | 2,5-DIBROMOPYRIDINE-3-BORONIC ACID Preparation Products And Raw materials |
|