| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
(+)-beta-Pinene manufacturers
- (+)-BETA-PINENE
-
- $1.00
-
2019-12-24
- CAS:19902-08-0
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10t
|
| | (+)-beta-Pinene Basic information |
| Product Name: | (+)-beta-Pinene | | Synonyms: | (+)-B-PINENE;(1R,5R)-2(10)-PINENE;D-BETA-PINENE;(1R,5R)-2(10)-Pinene, (1R,5R)-6,6-Dimethyl-2-methylenebicyclo[3.1.1]heptane;(1α,5α)-2-Methylene-6,6-dimethylbicyclo[3.1.1]heptane;[1R,5R,(+)]-Pin-2(10)-ene;(+)-β-Pinene,(1R,5R)-2(10)-Pinene, (1R,5R)-6,6-Dimethyl-2-methylenebicyclo[3.1.1]heptane;Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene-, (1R,5R)- | | CAS: | 19902-08-0 | | MF: | C10H16 | | MW: | 136.23 | | EINECS: | | | Product Categories: | | | Mol File: | 19902-08-0.mol |  |
| | (+)-beta-Pinene Chemical Properties |
| Melting point | -50°C | | Boiling point | 164-165 °C(lit.) | | density | 0.872 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.478(lit.) | | Fp | 36 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | Odor | at 10.00 % in dipropylene glycol. sweet fresh pine woody hay green | | Odor Type | terpenic | | Optical Rotation | [α]20/D +22±1°, neat | | BRN | 3587586 | | Stability: | Light Sensitive | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 | | InChIKey | WTARULDDTDQWMU-RKDXNWHRSA-N | | SMILES | [H][C@@]12CCC(=C)[C@@]([H])(C1)C2(C)C | | LogP | 4.24 |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36-36/37/39-16 | | RIDADR | UN 2319 3/PG 3 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | (+)-beta-Pinene Usage And Synthesis |
| Uses | (+)-b-Pinene is a monoterpene that naturally occur in various plants, shown to have antibiotic and antifungal activity. | | Definition | ChEBI: (+)-beta-pinene is a beta-pinene. It is an enantiomer of a (-)-beta-pinene. |
| | (+)-beta-Pinene Preparation Products And Raw materials |
|