| Company Name: |
Puripharm Co., Ltd. Gold |
| Tel: |
0572-2745768-1 13167223168;13167223168 |
| Email: |
sales@puripharm.com |
4-METHYLTHIAZOLE-2-THIOL manufacturers
|
| | 4-METHYLTHIAZOLE-2-THIOL Basic information |
| Product Name: | 4-METHYLTHIAZOLE-2-THIOL | | Synonyms: | 4-METHYLTHIAZOLE-2-THIOL;4-METHYL-1,3-THIAZOLE-2-THIOL;AKOS BBS-00004642;4-Methylthiazole-2-thiol 97%;4-Methyl-1,3-thiazole-2-thiol 97%;4-Methyl-1,3-thiazole-2-thiol, 4-Methyl-2-sulphanyl-1,3-thiazole, 2-Mercapto-4-methyl-1,3-thiazole;4-Methyl-2-thio-1,3-thiazole 97%;4-Methyl-2-thio-1,3-thiazole97% | | CAS: | 4498-39-9 | | MF: | C4H5NS2 | | MW: | 131.22 | | EINECS: | | | Product Categories: | | | Mol File: | 4498-39-9.mol |  |
| | 4-METHYLTHIAZOLE-2-THIOL Chemical Properties |
| Melting point | 86-89℃ | | Sensitive | Air Sensitive | | InChI | InChI=1S/C4H5NS2/c1-3-2-7-4(6)5-3/h2H,1H3,(H,5,6) | | InChIKey | NLHAIPFBNQZTMY-UHFFFAOYSA-N | | SMILES | C1(C)=CSC(S)=N1 | | CAS DataBase Reference | 4498-39-9(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | Hazard Note | Air Sensitive | | TSCA | Yes |
| Provider | Language |
|
ALFA
| English |
| | 4-METHYLTHIAZOLE-2-THIOL Usage And Synthesis |
| | 4-METHYLTHIAZOLE-2-THIOL Preparation Products And Raw materials |
|