|
|
| | 2-Methyl-2-butenenitrile Basic information |
| Product Name: | 2-Methyl-2-butenenitrile | | Synonyms: | 2,3-DIMETHYLACRYLONITRILE;1-METHYL-1-PROPENYL CYANIDE;2-CYANO-2-BUTENE;2-methyl-2-butenenitril;2-methyl-crotononitril;2-methylcrotononitrile;alpha,beta-dimethylacrylonitrile;alpha-methylcrotononitrile | | CAS: | 4403-61-6 | | MF: | C5H7N | | MW: | 81.12 | | EINECS: | 224-544-5 | | Product Categories: | | | Mol File: | 4403-61-6.mol |  |
| | 2-Methyl-2-butenenitrile Chemical Properties |
| Boiling point | 115-120 °C(lit.) | | density | 0.810 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.417 | | Fp | -17 °C | | Water Solubility | Slightly soluble in water | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C5H7N/c1-3-5(2)4-6/h3H,1-2H3 | | InChIKey | IHXNSHZBFXGOJM-UHFFFAOYSA-N | | SMILES | C(#N)C(C)=CC | | CAS DataBase Reference | 4403-61-6 | | EPA Substance Registry System | 2-Methyl-2-butenenitrile (4403-61-6) |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/22 | | Safety Statements | 16-23-36/37 | | RIDADR | UN 3273 3/PG 2 | | WGK Germany | 3 | | RTECS | EM8312500 | | HS Code | 2926.90.5050 | | HazardClass | 3.1 | | PackingGroup | I |
| | 2-Methyl-2-butenenitrile Usage And Synthesis |
| General Description | Clear amber liquid. | | Air & Water Reactions | Highly flammable. 2-METHYL-2-BUTENENITRILE may be sensitive to prolonged exposure to air. . Insoluble in water. | | Reactivity Profile | Nitriles, such as 2-METHYL-2-BUTENENITRILE, may polymerize in the presence of metals and some metal compounds. They are incompatible with acids; mixing nitriles with strong oxidizing acids can lead to extremely violent reactions. Nitriles are generally incompatible with other oxidizing agents such as peroxides and epoxides. The combination of bases and nitriles can produce hydrogen cyanide. Nitriles are hydrolyzed in both aqueous acid and base to give carboxylic acids (or salts of carboxylic acids). These reactions generate heat. Peroxides convert nitriles to amides. Nitriles can react vigorously with reducing agents. Acetonitrile and propionitrile are soluble in water, but nitriles higher than propionitrile have low aqueous solubility. They are also insoluble in aqueous acids. | | Fire Hazard | 2-METHYL-2-BUTENENITRILE is flammable. |
| | 2-Methyl-2-butenenitrile Preparation Products And Raw materials |
|