|
|
| | 2-METHYL-3-BUTENENITRILE Basic information |
| Product Name: | 2-METHYL-3-BUTENENITRILE | | Synonyms: | 2-methyl-3-butenenitril;3-Butenenitrile, 2-methyl-;3-CYANO-1-BUTENE;2-METHYL-3-BUTENENITRILE 70+%;2-Methyl-3-butenitrile, tech-95;3-cyanobut-1-ene;ai3-30534;2-METHYL-3-BUTENENITRILE | | CAS: | 16529-56-9 | | MF: | C5H7N | | MW: | 81.12 | | EINECS: | 240-596-1 | | Product Categories: | | | Mol File: | 16529-56-9.mol |  |
| | 2-METHYL-3-BUTENENITRILE Chemical Properties |
| Boiling point | 124 °C | | density | 0,82 g/cm3 | | refractive index | 1.4070 to 1.4110 | | Fp | 15°C | | Water Solubility | Slightly soluble in water | | form | clear liquid | | Specific Gravity | 0.82 | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C5H7N/c1-3-5(2)4-6/h3,5H,1H2,2H3 | | InChIKey | WBAXCOMEMKANRN-UHFFFAOYSA-N | | SMILES | C(#N)C(C)C=C | | EPA Substance Registry System | 2-Methyl-3-butenenitrile (16529-56-9) |
| Risk Statements | 11-20/21/22 | | Safety Statements | 16-26-36/37/39 | | RIDADR | 3275 | | TSCA | TSCA listed | | HS Code | 2926.90.5050 | | HazardClass | 3.1 | | PackingGroup | I | | Toxicity | rat,LDLo,oral,1gm/kg (1000mg/kg),LUNGS, THORAX, OR RESPIRATION: DYSPNEAGASTROINTESTINAL: CHANGES IN STRUCTURE OR FUNCTION OF SALIVARY GLANDS,National Technical Information Service. Vol. OTS0571510, |
| | 2-METHYL-3-BUTENENITRILE Usage And Synthesis |
| General Description | Clear yellow liquid. | | Air & Water Reactions | Highly flammable. Soluble in water. | | Reactivity Profile | Nitriles, such as 2-METHYL-3-BUTENENITRILE, may polymerize in the presence of metals and some metal compounds. They are incompatible with acids; mixing nitriles with strong oxidizing acids can lead to extremely violent reactions. Nitriles are generally incompatible with other oxidizing agents such as peroxides and epoxides. The combination of bases and nitriles can produce hydrogen cyanide. Nitriles are hydrolyzed in both aqueous acid and base to give carboxylic acids (or salts of carboxylic acids). These reactions generate heat. Peroxides convert nitriles to amides. Nitriles can react vigorously with reducing agents. Acetonitrile and propionitrile are soluble in water, but nitriles higher than propionitrile have low aqueous solubility. They are also insoluble in aqueous acids. | | Fire Hazard | 2-METHYL-3-BUTENENITRILE is flammable. |
| | 2-METHYL-3-BUTENENITRILE Preparation Products And Raw materials |
|